C19H27N3O4S — CID 97166989
tert-butyl N-[(3R)-1-[(4-cyanophenyl)methylsulfonyl]piperidin-3-yl]-N-methylcarbamate (PubChem CID 97166989) has the molecular formula C19H27N3O4S and a molecular weight of 393.51 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[(4-cyanophenyl)methylsulfonyl]piperidin-3-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(3R)-1-[(4-cyanophenyl)methylsulfonyl]piperidin-3-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 97166989 |
| Molecular Formula | C19H27N3O4S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | tert-butyl N-[(3R)-1-[(4-cyanophenyl)methylsulfonyl]piperidin-3-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)[C@@H]1CCCN(S(=O)(=O)Cc2ccc(C#N)cc2)C1 |
| InChI | InChI=1S/C19H27N3O4S/c1-19(2,3)26-18(23)21(4)17-6-5-11-22(13-17)27(24,25)14-16-9-7-15(12-20)8-10-16/h7-10,17H,5-6,11,13-14H2,1-4H3/t17-/m1/s1 |
| InChIKey | CUFHNRRMQYYOBS-QGZVFWFLSA-N |
| XLogP | 2.72 |
| TPSA | 90.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |