C20H34O4Si — CID 102254910
tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3-phenylbutanoate (PubChem CID 102254910) has the molecular formula C20H34O4Si and a molecular weight of 366.57 g/mol. Its IUPAC name is tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3-phenylbutanoate.
| Compound Name | tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3-phenylbutanoate |
|---|---|
| PubChem CID | 102254910 |
| Molecular Formula | C20H34O4Si |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3-phenylbutanoate |
| SMILES | CC(C)(C)OC(=O)C(O[Si](C)(C)C(C)(C)C)C(C)(O)c1ccccc1 |
| InChI | InChI=1S/C20H34O4Si/c1-18(2,3)23-17(21)16(24-25(8,9)19(4,5)6)20(7,22)15-13-11-10-12-14-15/h10-14,16,22H,1-9H3 |
| InChIKey | RKMYEAUJADCREV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|