C21H30O6 — CID 102255916
6-methoxy-2,2-dimethyl-7,7-bis(2-methylbut-3-en-2-yloxy)-4H-1,3-benzodioxin-8-one (PubChem CID 102255916) has the molecular formula C21H30O6 and a molecular weight of 378.47 g/mol. Its IUPAC name is 6-methoxy-2,2-dimethyl-7,7-bis(2-methylbut-3-en-2-yloxy)-4H-1,3-benzodioxin-8-one.
| Compound Name | 6-methoxy-2,2-dimethyl-7,7-bis(2-methylbut-3-en-2-yloxy)-4H-1,3-benzodioxin-8-one |
|---|---|
| PubChem CID | 102255916 |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 6-methoxy-2,2-dimethyl-7,7-bis(2-methylbut-3-en-2-yloxy)-4H-1,3-benzodioxin-8-one |
| SMILES | C=CC(C)(C)OC1(OC(C)(C)C=C)C(=O)C2=C(C=C1OC)COC(C)(C)O2 |
| InChI | InChI=1S/C21H30O6/c1-10-18(3,4)26-21(27-19(5,6)11-2)15(23-9)12-14-13-24-20(7,8)25-16(14)17(21)22/h10-12H,1-2,13H2,3-9H3 |
| InChIKey | NWUMJZICXDKUDV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|