C16H16BrClO3 — CID 102256089
1-(bromomethyl)-3-[(4-chlorophenoxy)methyl]-2,5-dimethoxybenzene (PubChem CID 102256089) has the molecular formula C16H16BrClO3 and a molecular weight of 371.66 g/mol. Its IUPAC name is 1-(bromomethyl)-3-[(4-chlorophenoxy)methyl]-2,5-dimethoxybenzene.
| Compound Name | 1-(bromomethyl)-3-[(4-chlorophenoxy)methyl]-2,5-dimethoxybenzene |
|---|---|
| PubChem CID | 102256089 |
| Molecular Formula | C16H16BrClO3 |
| Molecular Weight | 371.66 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | 1-(bromomethyl)-3-[(4-chlorophenoxy)methyl]-2,5-dimethoxybenzene |
| SMILES | COc1cc(CBr)c(OC)c(COc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C16H16BrClO3/c1-19-15-7-11(9-17)16(20-2)12(8-15)10-21-14-5-3-13(18)4-6-14/h3-8H,9-10H2,1-2H3 |
| InChIKey | SWCIBPJSUCKNQL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.66 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|