C22H28N2O2 — CID 102257186
tert-butyl 3-[(Z)-5-cyanooct-4-en-4-yl]indole-1-carboxylate (PubChem CID 102257186) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is tert-butyl 3-[(Z)-5-cyanooct-4-en-4-yl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[(Z)-5-cyanooct-4-en-4-yl]indole-1-carboxylate |
|---|---|
| PubChem CID | 102257186 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | tert-butyl 3-[(Z)-5-cyanooct-4-en-4-yl]indole-1-carboxylate |
| SMILES | CCC/C(C#N)=C(\CCC)c1cn(C(=O)OC(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C22H28N2O2/c1-6-10-16(14-23)17(11-7-2)19-15-24(21(25)26-22(3,4)5)20-13-9-8-12-18(19)20/h8-9,12-13,15H,6-7,10-11H2,1-5H3/b17-16- |
| InChIKey | TVBJMLOGMZQWFA-MSUUIHNZSA-N |
| XLogP | 6.30 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|