C19H16F2O2 — CID 102257485
cis-(5S,6R)-5,6-bis(4-fluorophenyl)cycloheptane-1,3-dione (PubChem CID 102257485) has the molecular formula C19H16F2O2 and a molecular weight of 314.33 g/mol. Its IUPAC name is cis-(5S,6R)-5,6-bis(4-fluorophenyl)cycloheptane-1,3-dione.
| Compound Name | cis-(5S,6R)-5,6-bis(4-fluorophenyl)cycloheptane-1,3-dione |
|---|---|
| PubChem CID | 102257485 |
| Molecular Formula | C19H16F2O2 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | cis-(5S,6R)-5,6-bis(4-fluorophenyl)cycloheptane-1,3-dione |
| SMILES | O=C1CC(=O)C[C@@H](c2ccc(F)cc2)[C@@H](c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C19H16F2O2/c20-14-5-1-12(2-6-14)18-10-16(22)9-17(23)11-19(18)13-3-7-15(21)8-4-13/h1-8,18-19H,9-11H2/t18-,19+ |
| InChIKey | WHXBNPQAQOBVCH-KDURUIRLSA-N |
| XLogP | 4.15 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|