C14H28F3NOS — CID 102258354
2-methyl-N-[(2S)-1,1,1-trifluorodecan-2-yl]propane-2-sulfinamide (PubChem CID 102258354) has the molecular formula C14H28F3NOS and a molecular weight of 315.45 g/mol. Its IUPAC name is 2-methyl-N-[(2S)-1,1,1-trifluorodecan-2-yl]propane-2-sulfinamide.
| Compound Name | 2-methyl-N-[(2S)-1,1,1-trifluorodecan-2-yl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 102258354 |
| Molecular Formula | C14H28F3NOS |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 2-methyl-N-[(2S)-1,1,1-trifluorodecan-2-yl]propane-2-sulfinamide |
| SMILES | CCCCCCCC[C@H](NS(=O)C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C14H28F3NOS/c1-5-6-7-8-9-10-11-12(14(15,16)17)18-20(19)13(2,3)4/h12,18H,5-11H2,1-4H3/t12-,20?/m0/s1 |
| InChIKey | DPCLZHWZMJXLKT-SVZXGPMESA-N |
| XLogP | 4.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|