C24H30FNO10 — CID 102258663
1-O-tert-butyl 3-O,3-O'-dimethyl (2R,5R)-5-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-2-(4-fluorophenyl)pyrrolidine-1,3,3-tricarboxylate (PubChem CID 102258663) has the molecular formula C24H30FNO10 and a molecular weight of 511.50 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O,3-O'-dimethyl (2R,5R)-5-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-2-(4-fluorophenyl)pyrrolidine-1,3,3-tricarboxylate.
| Compound Name | 1-O-tert-butyl 3-O,3-O'-dimethyl (2R,5R)-5-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-2-(4-fluorophenyl)pyrrolidine-1,3,3-tricarboxylate |
|---|---|
| PubChem CID | 102258663 |
| Molecular Formula | C24H30FNO10 |
| Molecular Weight | 511.50 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | 1-O-tert-butyl 3-O,3-O'-dimethyl (2R,5R)-5-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-2-(4-fluorophenyl)pyrrolidine-1,3,3-tricarboxylate |
| SMILES | COC(=O)C(C(=O)OC)[C@H]1CC(C(=O)OC)(C(=O)OC)[C@@H](c2ccc(F)cc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H30FNO10/c1-23(2,3)36-22(31)26-15(16(18(27)32-4)19(28)33-5)12-24(20(29)34-6,21(30)35-7)17(26)13-8-10-14(25)11-9-13/h8-11,15-17H,12H2,1-7H3/t15-,17-/m1/s1 |
| InChIKey | HGSGDSHQCTZGRM-NVXWUHKLSA-N |
| XLogP | 2.17 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.50 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|