C9H16O2 — CID 102259371
trans-(1S,2R)-2-ethenyl-2-(hydroxymethyl)-1-methylcyclopentan-1-ol (PubChem CID 102259371) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is trans-(1S,2R)-2-ethenyl-2-(hydroxymethyl)-1-methylcyclopentan-1-ol.
| Compound Name | trans-(1S,2R)-2-ethenyl-2-(hydroxymethyl)-1-methylcyclopentan-1-ol |
|---|---|
| PubChem CID | 102259371 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | trans-(1S,2R)-2-ethenyl-2-(hydroxymethyl)-1-methylcyclopentan-1-ol |
| SMILES | C=C[C@@]1(CO)CCC[C@]1(C)O |
| InChI | InChI=1S/C9H16O2/c1-3-9(7-10)6-4-5-8(9,2)11/h3,10-11H,1,4-7H2,2H3/t8-,9-/m0/s1 |
| InChIKey | TVBGDWZCFYZYPG-IUCAKERBSA-N |
| XLogP | 1.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|