C9H16O2 — CID 170563604
2-ethenyl-2-ethylcyclopentane-1,3-diol (PubChem CID 170563604) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is 2-ethenyl-2-ethylcyclopentane-1,3-diol.
| Compound Name | 2-ethenyl-2-ethylcyclopentane-1,3-diol |
|---|---|
| PubChem CID | 170563604 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 2-ethenyl-2-ethylcyclopentane-1,3-diol |
| SMILES | C=CC1(CC)C(O)CCC1O |
| InChI | InChI=1S/C9H16O2/c1-3-9(4-2)7(10)5-6-8(9)11/h3,7-8,10-11H,1,4-6H2,2H3 |
| InChIKey | KTAVATPNAAVRQD-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|