C20H20ClNO7S — CID 10226078
ethyl (2Z)-2-[(4-chlorophenyl)-(4-methylsulfonylphenyl)methylidene]-4-nitrooxybutanoate (PubChem CID 10226078) has the molecular formula C20H20ClNO7S and a molecular weight of 453.90 g/mol. Its IUPAC name is ethyl (2Z)-2-[(4-chlorophenyl)-(4-methylsulfonylphenyl)methylidene]-4-nitrooxybutanoate.
| Compound Name | ethyl (2Z)-2-[(4-chlorophenyl)-(4-methylsulfonylphenyl)methylidene]-4-nitrooxybutanoate |
|---|---|
| PubChem CID | 10226078 |
| Molecular Formula | C20H20ClNO7S |
| Molecular Weight | 453.90 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | ethyl (2Z)-2-[(4-chlorophenyl)-(4-methylsulfonylphenyl)methylidene]-4-nitrooxybutanoate |
| SMILES | CCOC(=O)/C(CCO[N+](=O)[O-])=C(\c1ccc(Cl)cc1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H20ClNO7S/c1-3-28-20(23)18(12-13-29-22(24)25)19(14-4-8-16(21)9-5-14)15-6-10-17(11-7-15)30(2,26)27/h4-11H,3,12-13H2,1-2H3/b19-18+ |
| InChIKey | CUKIPZCSRWOROY-VHEBQXMUSA-N |
| XLogP | 3.71 |
| TPSA | 112.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.90 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|