C21H19ClF2O5S — CID 15527371
ethyl (2Z)-2-[(4-chlorophenyl)methylidene]-5,5-difluoro-4-(4-methylphenyl)sulfonyloxypent-4-enoate (PubChem CID 15527371) has the molecular formula C21H19ClF2O5S and a molecular weight of 456.89 g/mol. Its IUPAC name is ethyl (2Z)-2-[(4-chlorophenyl)methylidene]-5,5-difluoro-4-(4-methylphenyl)sulfonyloxypent-4-enoate.
| Compound Name | ethyl (2Z)-2-[(4-chlorophenyl)methylidene]-5,5-difluoro-4-(4-methylphenyl)sulfonyloxypent-4-enoate |
|---|---|
| PubChem CID | 15527371 |
| Molecular Formula | C21H19ClF2O5S |
| Molecular Weight | 456.89 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | ethyl (2Z)-2-[(4-chlorophenyl)methylidene]-5,5-difluoro-4-(4-methylphenyl)sulfonyloxypent-4-enoate |
| SMILES | CCOC(=O)/C(=C\c1ccc(Cl)cc1)CC(OS(=O)(=O)c1ccc(C)cc1)=C(F)F |
| InChI | InChI=1S/C21H19ClF2O5S/c1-3-28-21(25)16(12-15-6-8-17(22)9-7-15)13-19(20(23)24)29-30(26,27)18-10-4-14(2)5-11-18/h4-12H,3,13H2,1-2H3/b16-12- |
| InChIKey | OXRVBINRASUQMF-VBKFSLOCSA-N |
| XLogP | 5.50 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.89 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|