C21H18Cl2F2O5S — CID 15527370
ethyl (2Z)-2-[(2,4-dichlorophenyl)methylidene]-5,5-difluoro-4-(4-methylphenyl)sulfonyloxypent-4-enoate (PubChem CID 15527370) has the molecular formula C21H18Cl2F2O5S and a molecular weight of 491.34 g/mol. Its IUPAC name is ethyl (2Z)-2-[(2,4-dichlorophenyl)methylidene]-5,5-difluoro-4-(4-methylphenyl)sulfonyloxypent-4-enoate.
| Compound Name | ethyl (2Z)-2-[(2,4-dichlorophenyl)methylidene]-5,5-difluoro-4-(4-methylphenyl)sulfonyloxypent-4-enoate |
|---|---|
| PubChem CID | 15527370 |
| Molecular Formula | C21H18Cl2F2O5S |
| Molecular Weight | 491.34 g/mol |
| Exact Mass | 490.02 |
| IUPAC Name | ethyl (2Z)-2-[(2,4-dichlorophenyl)methylidene]-5,5-difluoro-4-(4-methylphenyl)sulfonyloxypent-4-enoate |
| SMILES | CCOC(=O)/C(=C\c1ccc(Cl)cc1Cl)CC(OS(=O)(=O)c1ccc(C)cc1)=C(F)F |
| InChI | InChI=1S/C21H18Cl2F2O5S/c1-3-29-21(26)15(10-14-6-7-16(22)12-18(14)23)11-19(20(24)25)30-31(27,28)17-8-4-13(2)5-9-17/h4-10,12H,3,11H2,1-2H3/b15-10- |
| InChIKey | SNYMVWODKUFWEJ-GDNBJRDFSA-N |
| XLogP | 6.15 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.34 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|