C20H19ClO5S — CID 132501402
ethyl (2E,4E)-5-(4-chlorophenyl)-3-(4-methylphenyl)sulfonyloxypenta-2,4-dienoate (PubChem CID 132501402) has the molecular formula C20H19ClO5S and a molecular weight of 406.89 g/mol. Its IUPAC name is ethyl (2E,4E)-5-(4-chlorophenyl)-3-(4-methylphenyl)sulfonyloxypenta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-5-(4-chlorophenyl)-3-(4-methylphenyl)sulfonyloxypenta-2,4-dienoate |
|---|---|
| PubChem CID | 132501402 |
| Molecular Formula | C20H19ClO5S |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | ethyl (2E,4E)-5-(4-chlorophenyl)-3-(4-methylphenyl)sulfonyloxypenta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C(\C=C\c1ccc(Cl)cc1)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H19ClO5S/c1-3-25-20(22)14-18(11-8-16-6-9-17(21)10-7-16)26-27(23,24)19-12-4-15(2)5-13-19/h4-14H,3H2,1-2H3/b11-8+,18-14+ |
| InChIKey | DZJQCVHCTLJSKF-DWRJGLHPSA-N |
| XLogP | 4.51 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|