C19H18O5S — CID 24899891
methyl (2E,4E)-3-(4-methylphenyl)sulfonyloxy-5-phenylpenta-2,4-dienoate (PubChem CID 24899891) has the molecular formula C19H18O5S and a molecular weight of 358.42 g/mol. Its IUPAC name is methyl (2E,4E)-3-(4-methylphenyl)sulfonyloxy-5-phenylpenta-2,4-dienoate.
| Compound Name | methyl (2E,4E)-3-(4-methylphenyl)sulfonyloxy-5-phenylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 24899891 |
| Molecular Formula | C19H18O5S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | methyl (2E,4E)-3-(4-methylphenyl)sulfonyloxy-5-phenylpenta-2,4-dienoate |
| SMILES | COC(=O)/C=C(\C=C\c1ccccc1)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H18O5S/c1-15-8-12-18(13-9-15)25(21,22)24-17(14-19(20)23-2)11-10-16-6-4-3-5-7-16/h3-14H,1-2H3/b11-10+,17-14+ |
| InChIKey | KXHPTXWWCYYIFO-PKAMWHFSSA-N |
| XLogP | 3.47 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|