C18H20INO5S — CID 11060033
[(E)-3-amino-1-methoxy-1-oxobut-2-en-2-yl]-phenyliodanium;4-methylbenzenesulfonate (PubChem CID 11060033) has the molecular formula C18H20INO5S and a molecular weight of 489.33 g/mol. Its IUPAC name is [(E)-3-amino-1-methoxy-1-oxobut-2-en-2-yl]-phenyliodanium;4-methylbenzenesulfonate.
| Compound Name | [(E)-3-amino-1-methoxy-1-oxobut-2-en-2-yl]-phenyliodanium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11060033 |
| Molecular Formula | C18H20INO5S |
| Molecular Weight | 489.33 g/mol |
| Exact Mass | 489.01 |
| IUPAC Name | [(E)-3-amino-1-methoxy-1-oxobut-2-en-2-yl]-phenyliodanium;4-methylbenzenesulfonate |
| SMILES | COC(=O)/C([I+]c1ccccc1)=C(/C)N.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C11H12INO2.C7H8O3S/c1-8(13)10(11(14)15-2)12-9-6-4-3-5-7-9;1-6-2-4-7(5-3-6)11(8,9)10/h3-7H,1-2H3,(H-,13,14);2-5H,1H3,(H,8,9,10) |
| InChIKey | KEAKWWUHENCAHM-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 109.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.33 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|