C20H24INO5S — CID 135051962
ethyl (E)-3-(methylamino)-2-[(4-methylphenyl)sulfonyloxy-phenyl-λ3-iodanyl]but-2-enoate (PubChem CID 135051962) has the molecular formula C20H24INO5S and a molecular weight of 517.39 g/mol. Its IUPAC name is ethyl (E)-3-(methylamino)-2-[(4-methylphenyl)sulfonyloxy-phenyl-λ3-iodanyl]but-2-enoate.
| Compound Name | ethyl (E)-3-(methylamino)-2-[(4-methylphenyl)sulfonyloxy-phenyl-λ3-iodanyl]but-2-enoate |
|---|---|
| PubChem CID | 135051962 |
| Molecular Formula | C20H24INO5S |
| Molecular Weight | 517.39 g/mol |
| Exact Mass | 517.04 |
| IUPAC Name | ethyl (E)-3-(methylamino)-2-[(4-methylphenyl)sulfonyloxy-phenyl-λ3-iodanyl]but-2-enoate |
| SMILES | CCOC(=O)/C(=C(/C)NC)I(OS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H24INO5S/c1-5-26-20(23)19(16(3)22-4)21(17-9-7-6-8-10-17)27-28(24,25)18-13-11-15(2)12-14-18/h6-14,22H,5H2,1-4H3/b19-16+ |
| InChIKey | SJQCGEAYZNHGRA-KNTRCKAVSA-N |
| XLogP | 4.01 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|