C25H26INO5S — CID 134877982
methyl (E)-3-(benzylamino)-2-[(4-methylphenyl)sulfonyloxy-phenyl-λ3-iodanyl]but-2-enoate (PubChem CID 134877982) has the molecular formula C25H26INO5S and a molecular weight of 579.46 g/mol. Its IUPAC name is methyl (E)-3-(benzylamino)-2-[(4-methylphenyl)sulfonyloxy-phenyl-λ3-iodanyl]but-2-enoate.
| Compound Name | methyl (E)-3-(benzylamino)-2-[(4-methylphenyl)sulfonyloxy-phenyl-λ3-iodanyl]but-2-enoate |
|---|---|
| PubChem CID | 134877982 |
| Molecular Formula | C25H26INO5S |
| Molecular Weight | 579.46 g/mol |
| Exact Mass | 579.06 |
| IUPAC Name | methyl (E)-3-(benzylamino)-2-[(4-methylphenyl)sulfonyloxy-phenyl-λ3-iodanyl]but-2-enoate |
| SMILES | COC(=O)/C(=C(/C)NCc1ccccc1)I(OS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H26INO5S/c1-19-14-16-23(17-15-19)33(29,30)32-26(22-12-8-5-9-13-22)24(25(28)31-3)20(2)27-18-21-10-6-4-7-11-21/h4-17,27H,18H2,1-3H3/b24-20+ |
| InChIKey | HDBCANQFMMGCKS-HIXSDJFHSA-N |
| XLogP | 5.19 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|