C21H24N2O4S — CID 102079478
methyl (2Z)-2-[1-(4-methylphenyl)sulfonyl-7-phenyl-1,4-diazepan-5-ylidene]acetate (PubChem CID 102079478) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is methyl (2Z)-2-[1-(4-methylphenyl)sulfonyl-7-phenyl-1,4-diazepan-5-ylidene]acetate.
| Compound Name | methyl (2Z)-2-[1-(4-methylphenyl)sulfonyl-7-phenyl-1,4-diazepan-5-ylidene]acetate |
|---|---|
| PubChem CID | 102079478 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | methyl (2Z)-2-[1-(4-methylphenyl)sulfonyl-7-phenyl-1,4-diazepan-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1/CC(c2ccccc2)N(S(=O)(=O)c2ccc(C)cc2)CCN1 |
| InChI | InChI=1S/C21H24N2O4S/c1-16-8-10-19(11-9-16)28(25,26)23-13-12-22-18(15-21(24)27-2)14-20(23)17-6-4-3-5-7-17/h3-11,15,20,22H,12-14H2,1-2H3/b18-15- |
| InChIKey | RVJZLCGMTPJNSQ-SDXDJHTJSA-N |
| XLogP | 2.78 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|