C25H26INO4S — CID 11215155
[(E)-2-(benzylamino)-4-oxopent-2-en-3-yl]-phenyliodanium;4-methylbenzenesulfonate (PubChem CID 11215155) has the molecular formula C25H26INO4S and a molecular weight of 563.46 g/mol. Its IUPAC name is [(E)-2-(benzylamino)-4-oxopent-2-en-3-yl]-phenyliodanium;4-methylbenzenesulfonate.
| Compound Name | [(E)-2-(benzylamino)-4-oxopent-2-en-3-yl]-phenyliodanium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11215155 |
| Molecular Formula | C25H26INO4S |
| Molecular Weight | 563.46 g/mol |
| Exact Mass | 563.06 |
| IUPAC Name | [(E)-2-(benzylamino)-4-oxopent-2-en-3-yl]-phenyliodanium;4-methylbenzenesulfonate |
| SMILES | CC(=O)/C([I+]c1ccccc1)=C(/C)NCc1ccccc1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C18H18INO.C7H8O3S/c1-14(20-13-16-9-5-3-6-10-16)18(15(2)21)19-17-11-7-4-8-12-17;1-6-2-4-7(5-3-6)11(8,9)10/h3-12H,13H2,1-2H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | AIOQOIMZXAEMRN-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.46 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|