C25H26INO4S — CID 135051983
[[(E)-2-(benzylamino)-4-oxopent-2-en-3-yl]-phenyl-λ3-iodanyl] 4-methylbenzenesulfonate (PubChem CID 135051983) has the molecular formula C25H26INO4S and a molecular weight of 563.46 g/mol. Its IUPAC name is [[(E)-2-(benzylamino)-4-oxopent-2-en-3-yl]-phenyl-λ3-iodanyl] 4-methylbenzenesulfonate.
| Compound Name | [[(E)-2-(benzylamino)-4-oxopent-2-en-3-yl]-phenyl-λ3-iodanyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 135051983 |
| Molecular Formula | C25H26INO4S |
| Molecular Weight | 563.46 g/mol |
| Exact Mass | 563.06 |
| IUPAC Name | [[(E)-2-(benzylamino)-4-oxopent-2-en-3-yl]-phenyl-λ3-iodanyl] 4-methylbenzenesulfonate |
| SMILES | CC(=O)/C(=C(/C)NCc1ccccc1)I(OS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H26INO4S/c1-19-14-16-24(17-15-19)32(29,30)31-26(23-12-8-5-9-13-23)25(21(3)28)20(2)27-18-22-10-6-4-7-11-22/h4-17,27H,18H2,1-3H3/b25-20+ |
| InChIKey | VUUOESLYXFEWJE-LKUDQCMESA-N |
| XLogP | 5.60 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.46 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|