C26H28INO5S — CID 15354612
ethyl (E)-3-(benzylamino)-2-[(4-methylphenyl)sulfonyloxy-phenyl-λ3-iodanyl]but-2-enoate (PubChem CID 15354612) has the molecular formula C26H28INO5S and a molecular weight of 593.48 g/mol. Its IUPAC name is ethyl (E)-3-(benzylamino)-2-[(4-methylphenyl)sulfonyloxy-phenyl-λ3-iodanyl]but-2-enoate.
| Compound Name | ethyl (E)-3-(benzylamino)-2-[(4-methylphenyl)sulfonyloxy-phenyl-λ3-iodanyl]but-2-enoate |
|---|---|
| PubChem CID | 15354612 |
| Molecular Formula | C26H28INO5S |
| Molecular Weight | 593.48 g/mol |
| Exact Mass | 593.07 |
| IUPAC Name | ethyl (E)-3-(benzylamino)-2-[(4-methylphenyl)sulfonyloxy-phenyl-λ3-iodanyl]but-2-enoate |
| SMILES | CCOC(=O)/C(=C(/C)NCc1ccccc1)I(OS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H28INO5S/c1-4-32-26(29)25(21(3)28-19-22-11-7-5-8-12-22)27(23-13-9-6-10-14-23)33-34(30,31)24-17-15-20(2)16-18-24/h5-18,28H,4,19H2,1-3H3/b25-21+ |
| InChIKey | KPAPINQDHJQVKB-NJNXFGOHSA-N |
| XLogP | 5.58 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.48 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|