C28H32N2O4S — CID 122218830
propyl (E)-3-(benzylamino)-2-[benzyl-(4-methylphenyl)sulfonylamino]but-2-enoate (PubChem CID 122218830) has the molecular formula C28H32N2O4S and a molecular weight of 492.64 g/mol. Its IUPAC name is propyl (E)-3-(benzylamino)-2-[benzyl-(4-methylphenyl)sulfonylamino]but-2-enoate.
| Compound Name | propyl (E)-3-(benzylamino)-2-[benzyl-(4-methylphenyl)sulfonylamino]but-2-enoate |
|---|---|
| PubChem CID | 122218830 |
| Molecular Formula | C28H32N2O4S |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | propyl (E)-3-(benzylamino)-2-[benzyl-(4-methylphenyl)sulfonylamino]but-2-enoate |
| SMILES | CCCOC(=O)/C(=C(/C)NCc1ccccc1)N(Cc1ccccc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H32N2O4S/c1-4-19-34-28(31)27(23(3)29-20-24-11-7-5-8-12-24)30(21-25-13-9-6-10-14-25)35(32,33)26-17-15-22(2)16-18-26/h5-18,29H,4,19-21H2,1-3H3/b27-23+ |
| InChIKey | DMRFVSJPUVFEGN-SLEBQGDGSA-N |
| XLogP | 5.16 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|