C28H24FNO6S — CID 73212227
dimethyl (E)-2-[[3-(4-fluorophenyl)-1-phenylprop-2-ynyl]-(4-methylphenyl)sulfonylamino]but-2-enedioate (PubChem CID 73212227) has the molecular formula C28H24FNO6S and a molecular weight of 521.57 g/mol. Its IUPAC name is dimethyl (E)-2-[[3-(4-fluorophenyl)-1-phenylprop-2-ynyl]-(4-methylphenyl)sulfonylamino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[[3-(4-fluorophenyl)-1-phenylprop-2-ynyl]-(4-methylphenyl)sulfonylamino]but-2-enedioate |
|---|---|
| PubChem CID | 73212227 |
| Molecular Formula | C28H24FNO6S |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | dimethyl (E)-2-[[3-(4-fluorophenyl)-1-phenylprop-2-ynyl]-(4-methylphenyl)sulfonylamino]but-2-enedioate |
| SMILES | COC(=O)/C=C(\C(=O)OC)N(C(C#Cc1ccc(F)cc1)c1ccccc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H24FNO6S/c1-20-9-16-24(17-10-20)37(33,34)30(26(28(32)36-3)19-27(31)35-2)25(22-7-5-4-6-8-22)18-13-21-11-14-23(29)15-12-21/h4-12,14-17,19,25H,1-3H3/b26-19+ |
| InChIKey | JBSUNBRMLJHPND-LGUFXXKBSA-N |
| XLogP | 4.15 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|