C22H23NO4S — CID 135072950
ethyl (E)-3-[(4-methylphenyl)sulfonyl-(3-phenylprop-2-ynyl)amino]but-2-enoate (PubChem CID 135072950) has the molecular formula C22H23NO4S and a molecular weight of 397.50 g/mol. Its IUPAC name is ethyl (E)-3-[(4-methylphenyl)sulfonyl-(3-phenylprop-2-ynyl)amino]but-2-enoate.
| Compound Name | ethyl (E)-3-[(4-methylphenyl)sulfonyl-(3-phenylprop-2-ynyl)amino]but-2-enoate |
|---|---|
| PubChem CID | 135072950 |
| Molecular Formula | C22H23NO4S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | ethyl (E)-3-[(4-methylphenyl)sulfonyl-(3-phenylprop-2-ynyl)amino]but-2-enoate |
| SMILES | CCOC(=O)/C=C(\C)N(CC#Cc1ccccc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H23NO4S/c1-4-27-22(24)17-19(3)23(16-8-11-20-9-6-5-7-10-20)28(25,26)21-14-12-18(2)13-15-21/h5-7,9-10,12-15,17H,4,16H2,1-3H3/b19-17+ |
| InChIKey | NEHSLKZPAWPEEC-HTXNQAPBSA-N |
| XLogP | 3.50 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|