C21H21NO4S — CID 11485902
methyl (2Z)-2-[(4Z)-4-benzylidene-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]acetate (PubChem CID 11485902) has the molecular formula C21H21NO4S and a molecular weight of 383.47 g/mol. Its IUPAC name is methyl (2Z)-2-[(4Z)-4-benzylidene-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]acetate.
| Compound Name | methyl (2Z)-2-[(4Z)-4-benzylidene-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]acetate |
|---|---|
| PubChem CID | 11485902 |
| Molecular Formula | C21H21NO4S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | methyl (2Z)-2-[(4Z)-4-benzylidene-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]acetate |
| SMILES | COC(=O)/C=C1\CN(S(=O)(=O)c2ccc(C)cc2)C\C1=C/c1ccccc1 |
| InChI | InChI=1S/C21H21NO4S/c1-16-8-10-20(11-9-16)27(24,25)22-14-18(12-17-6-4-3-5-7-17)19(15-22)13-21(23)26-2/h3-13H,14-15H2,1-2H3/b18-12+,19-13+ |
| InChIKey | CMAVENJCFLYGEL-KLCVKJMQSA-N |
| XLogP | 3.18 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|