C16H21NO5S — CID 135045393
methyl [(Z)-4-[(4-methylphenyl)sulfonyl-prop-2-enylamino]but-2-enyl] carbonate (PubChem CID 135045393) has the molecular formula C16H21NO5S and a molecular weight of 339.41 g/mol. Its IUPAC name is methyl [(Z)-4-[(4-methylphenyl)sulfonyl-prop-2-enylamino]but-2-enyl] carbonate.
| Compound Name | methyl [(Z)-4-[(4-methylphenyl)sulfonyl-prop-2-enylamino]but-2-enyl] carbonate |
|---|---|
| PubChem CID | 135045393 |
| Molecular Formula | C16H21NO5S |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | methyl [(Z)-4-[(4-methylphenyl)sulfonyl-prop-2-enylamino]but-2-enyl] carbonate |
| SMILES | C=CCN(C/C=C\COC(=O)OC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H21NO5S/c1-4-11-17(12-5-6-13-22-16(18)21-3)23(19,20)15-9-7-14(2)8-10-15/h4-10H,1,11-13H2,2-3H3/b6-5- |
| InChIKey | ATWBWVPEOIGXFB-WAYWQWQTSA-N |
| XLogP | 2.51 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|