C21H18O7S2 — CID 10895577
[4-(4-methylphenyl)sulfonyloxy-5-oxocyclohepta-1,3,6-trien-1-yl] 4-methylbenzenesulfonate (PubChem CID 10895577) has the molecular formula C21H18O7S2 and a molecular weight of 446.50 g/mol. Its IUPAC name is [4-(4-methylphenyl)sulfonyloxy-5-oxocyclohepta-1,3,6-trien-1-yl] 4-methylbenzenesulfonate.
| Compound Name | [4-(4-methylphenyl)sulfonyloxy-5-oxocyclohepta-1,3,6-trien-1-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10895577 |
| Molecular Formula | C21H18O7S2 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | [4-(4-methylphenyl)sulfonyloxy-5-oxocyclohepta-1,3,6-trien-1-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(OS(=O)(=O)c3ccc(C)cc3)c(=O)cc2)cc1 |
| InChI | InChI=1S/C21H18O7S2/c1-15-3-9-18(10-4-15)29(23,24)27-17-7-13-20(22)21(14-8-17)28-30(25,26)19-11-5-16(2)6-12-19/h3-14H,1-2H3 |
| InChIKey | UQAPHTJIBDVZEX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|