C18H16F2O4S — CID 15261509
[(Z)-4,4-difluoro-1-(4-methylphenyl)-3-oxobut-1-en-2-yl] 4-methylbenzenesulfonate (PubChem CID 15261509) has the molecular formula C18H16F2O4S and a molecular weight of 366.39 g/mol. Its IUPAC name is [(Z)-4,4-difluoro-1-(4-methylphenyl)-3-oxobut-1-en-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [(Z)-4,4-difluoro-1-(4-methylphenyl)-3-oxobut-1-en-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 15261509 |
| Molecular Formula | C18H16F2O4S |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | [(Z)-4,4-difluoro-1-(4-methylphenyl)-3-oxobut-1-en-2-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(/C=C(\OS(=O)(=O)c2ccc(C)cc2)C(=O)C(F)F)cc1 |
| InChI | InChI=1S/C18H16F2O4S/c1-12-3-7-14(8-4-12)11-16(17(21)18(19)20)24-25(22,23)15-9-5-13(2)6-10-15/h3-11,18H,1-2H3/b16-11- |
| InChIKey | BLNGUXXFAHGIFD-WJDWOHSUSA-N |
| XLogP | 3.88 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|