C17H12ClF3O4S — CID 10668977
[(Z)-1-(4-chlorophenyl)-4,4,4-trifluoro-3-oxobut-1-en-2-yl] 4-methylbenzenesulfonate (PubChem CID 10668977) has the molecular formula C17H12ClF3O4S and a molecular weight of 404.79 g/mol. Its IUPAC name is [(Z)-1-(4-chlorophenyl)-4,4,4-trifluoro-3-oxobut-1-en-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [(Z)-1-(4-chlorophenyl)-4,4,4-trifluoro-3-oxobut-1-en-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10668977 |
| Molecular Formula | C17H12ClF3O4S |
| Molecular Weight | 404.79 g/mol |
| Exact Mass | 404.01 |
| IUPAC Name | [(Z)-1-(4-chlorophenyl)-4,4,4-trifluoro-3-oxobut-1-en-2-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O/C(=C\c2ccc(Cl)cc2)C(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H12ClF3O4S/c1-11-2-8-14(9-3-11)26(23,24)25-15(16(22)17(19,20)21)10-12-4-6-13(18)7-5-12/h2-10H,1H3/b15-10- |
| InChIKey | WKIJJIRJURSRRE-GDNBJRDFSA-N |
| XLogP | 4.53 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.79 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|