C19H15F3O4S — CID 10644433
[(3Z,5E)-1,1,1-trifluoro-2-oxo-6-phenylhexa-3,5-dien-3-yl] 4-methylbenzenesulfonate (PubChem CID 10644433) has the molecular formula C19H15F3O4S and a molecular weight of 396.39 g/mol. Its IUPAC name is [(3Z,5E)-1,1,1-trifluoro-2-oxo-6-phenylhexa-3,5-dien-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(3Z,5E)-1,1,1-trifluoro-2-oxo-6-phenylhexa-3,5-dien-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10644433 |
| Molecular Formula | C19H15F3O4S |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | [(3Z,5E)-1,1,1-trifluoro-2-oxo-6-phenylhexa-3,5-dien-3-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O/C(=C\C=C\c2ccccc2)C(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H15F3O4S/c1-14-10-12-16(13-11-14)27(24,25)26-17(18(23)19(20,21)22)9-5-8-15-6-3-2-4-7-15/h2-13H,1H3/b8-5+,17-9- |
| InChIKey | FEUHFZIMHMXHQD-WIXUPIFPSA-N |
| XLogP | 4.43 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|