C16H12F4O2S — CID 139250740
[(Z)-1,3,3,3-tetrafluoro-2-phenylprop-1-enyl] 4-methylbenzenesulfinate (PubChem CID 139250740) has the molecular formula C16H12F4O2S and a molecular weight of 344.33 g/mol. Its IUPAC name is [(Z)-1,3,3,3-tetrafluoro-2-phenylprop-1-enyl] 4-methylbenzenesulfinate.
| Compound Name | [(Z)-1,3,3,3-tetrafluoro-2-phenylprop-1-enyl] 4-methylbenzenesulfinate |
|---|---|
| PubChem CID | 139250740 |
| Molecular Formula | C16H12F4O2S |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | [(Z)-1,3,3,3-tetrafluoro-2-phenylprop-1-enyl] 4-methylbenzenesulfinate |
| SMILES | Cc1ccc(S(=O)O/C(F)=C(\c2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H12F4O2S/c1-11-7-9-13(10-8-11)23(21)22-15(17)14(16(18,19)20)12-5-3-2-4-6-12/h2-10H,1H3/b15-14+ |
| InChIKey | FDRLKRPCXZLWFY-CCEZHUSRSA-N |
| XLogP | 4.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|