C18H14F4O2S — CID 139250749
[(1Z,3E)-1-fluoro-4-phenyl-2-(trifluoromethyl)buta-1,3-dienyl] 4-methylbenzenesulfinate (PubChem CID 139250749) has the molecular formula C18H14F4O2S and a molecular weight of 370.37 g/mol. Its IUPAC name is [(1Z,3E)-1-fluoro-4-phenyl-2-(trifluoromethyl)buta-1,3-dienyl] 4-methylbenzenesulfinate.
| Compound Name | [(1Z,3E)-1-fluoro-4-phenyl-2-(trifluoromethyl)buta-1,3-dienyl] 4-methylbenzenesulfinate |
|---|---|
| PubChem CID | 139250749 |
| Molecular Formula | C18H14F4O2S |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | [(1Z,3E)-1-fluoro-4-phenyl-2-(trifluoromethyl)buta-1,3-dienyl] 4-methylbenzenesulfinate |
| SMILES | Cc1ccc(S(=O)O/C(F)=C(\C=C\c2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H14F4O2S/c1-13-7-10-15(11-8-13)25(23)24-17(19)16(18(20,21)22)12-9-14-5-3-2-4-6-14/h2-12H,1H3/b12-9+,17-16+ |
| InChIKey | QWGHYBWMGBQMLV-ZKOVZKHUSA-N |
| XLogP | 5.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|