C23H26O8S2 — CID 59053031
methyl (2Z,6E)-3,7-bis-(4-methylphenyl)sulfonyloxyocta-2,6-dienoate (PubChem CID 59053031) has the molecular formula C23H26O8S2 and a molecular weight of 494.59 g/mol. Its IUPAC name is methyl (2Z,6E)-3,7-bis-(4-methylphenyl)sulfonyloxyocta-2,6-dienoate.
| Compound Name | methyl (2Z,6E)-3,7-bis-(4-methylphenyl)sulfonyloxyocta-2,6-dienoate |
|---|---|
| PubChem CID | 59053031 |
| Molecular Formula | C23H26O8S2 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | methyl (2Z,6E)-3,7-bis-(4-methylphenyl)sulfonyloxyocta-2,6-dienoate |
| SMILES | COC(=O)/C=C(/CC/C=C(\C)OS(=O)(=O)c1ccc(C)cc1)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H26O8S2/c1-17-8-12-21(13-9-17)32(25,26)30-19(3)6-5-7-20(16-23(24)29-4)31-33(27,28)22-14-10-18(2)11-15-22/h6,8-16H,5,7H2,1-4H3/b19-6+,20-16- |
| InChIKey | MWGSFJFKMDGDEK-BFLAKMLJSA-N |
| XLogP | 4.16 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|