C20H21ClO5S — CID 54172540
ethyl 2-[(4-chlorophenyl)-(4-methylsulfonylphenyl)methylidene]-4-hydroxybutanoate (PubChem CID 54172540) has the molecular formula C20H21ClO5S and a molecular weight of 408.90 g/mol. Its IUPAC name is ethyl 2-[(4-chlorophenyl)-(4-methylsulfonylphenyl)methylidene]-4-hydroxybutanoate.
| Compound Name | ethyl 2-[(4-chlorophenyl)-(4-methylsulfonylphenyl)methylidene]-4-hydroxybutanoate |
|---|---|
| PubChem CID | 54172540 |
| Molecular Formula | C20H21ClO5S |
| Molecular Weight | 408.90 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | ethyl 2-[(4-chlorophenyl)-(4-methylsulfonylphenyl)methylidene]-4-hydroxybutanoate |
| SMILES | CCOC(=O)C(CCO)=C(c1ccc(Cl)cc1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H21ClO5S/c1-3-26-20(23)18(12-13-22)19(14-4-8-16(21)9-5-14)15-6-10-17(11-7-15)27(2,24)25/h4-11,22H,3,12-13H2,1-2H3 |
| InChIKey | OWAQKVRXYHBMOC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.90 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|