C44H40O3P2Si2 — CID 102261517
[13-(2-benzo[b]phosphindol-5-ylphenoxy)-16-trimethylsilyl-12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-10-yl]-trimethylsilane (PubChem CID 102261517) has the molecular formula C44H40O3P2Si2 and a molecular weight of 734.92 g/mol. Its IUPAC name is [13-(2-benzo[b]phosphindol-5-ylphenoxy)-16-trimethylsilyl-12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-10-yl]-trimethylsilane.
| Compound Name | [13-(2-benzo[b]phosphindol-5-ylphenoxy)-16-trimethylsilyl-12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-10-yl]-trimethylsilane |
|---|---|
| PubChem CID | 102261517 |
| Molecular Formula | C44H40O3P2Si2 |
| Molecular Weight | 734.92 g/mol |
| Exact Mass | 734.20 |
| IUPAC Name | [13-(2-benzo[b]phosphindol-5-ylphenoxy)-16-trimethylsilyl-12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-10-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1cc2ccccc2c2c1op(Oc1ccccc1-p1c3ccccc3c3ccccc31)oc1c([Si](C)(C)C)cc3ccccc3c12 |
| InChI | InChI=1S/C44H40O3P2Si2/c1-50(2,3)39-27-29-17-7-9-19-31(29)41-42-32-20-10-8-18-30(32)28-40(51(4,5)6)44(42)47-49(46-43(39)41)45-35-23-13-16-26-38(35)48-36-24-14-11-21-33(36)34-22-12-15-25-37(34)48/h7-28H,1-6H3 |
| InChIKey | NVMKYYZBLYOMDC-UHFFFAOYSA-N |
| XLogP | 13.81 |
| TPSA | 35.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.92 |
| LogP ≤ 5 | 13.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|