C25H26O2Si — CID 175847366
[3-methoxy-4-(2-methoxynaphthalen-1-yl)naphthalen-2-yl]-trimethylsilane (PubChem CID 175847366) has the molecular formula C25H26O2Si and a molecular weight of 386.57 g/mol. Its IUPAC name is [3-methoxy-4-(2-methoxynaphthalen-1-yl)naphthalen-2-yl]-trimethylsilane.
| Compound Name | [3-methoxy-4-(2-methoxynaphthalen-1-yl)naphthalen-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 175847366 |
| Molecular Formula | C25H26O2Si |
| Molecular Weight | 386.57 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | [3-methoxy-4-(2-methoxynaphthalen-1-yl)naphthalen-2-yl]-trimethylsilane |
| SMILES | COc1ccc2ccccc2c1-c1c(OC)c([Si](C)(C)C)cc2ccccc12 |
| InChI | InChI=1S/C25H26O2Si/c1-26-21-15-14-17-10-6-8-12-19(17)23(21)24-20-13-9-7-11-18(20)16-22(25(24)27-2)28(3,4)5/h6-16H,1-5H3 |
| InChIKey | PVYLQDQEQXQAQP-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.57 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|