About barium(2+);bis(1-(2-methoxynaphthalen-1-yl)naphthalen-2-olate)
barium(2+);bis(1-(2-methoxynaphthalen-1-yl)naphthalen-2-olate) (PubChem CID 10952722) has the molecular formula C42H30BaO4
and a molecular weight of 736.03 g/mol. Its IUPAC name is barium(2+);bis(1-(2-methoxynaphthalen-1-yl)naphthalen-2-olate).
Molecular Properties
| Compound Name | barium(2+);bis(1-(2-methoxynaphthalen-1-yl)naphthalen-2-olate) |
| PubChem CID | 10952722 |
| Molecular Formula | C42H30BaO4 |
| Molecular Weight | 736.03 g/mol |
| Exact Mass | 736.12 |
| IUPAC Name | barium(2+);bis(1-(2-methoxynaphthalen-1-yl)naphthalen-2-olate) |
| SMILES | COc1ccc2ccccc2c1-c1c([O-])ccc2ccccc12.COc1ccc2ccccc2c1-c1c([O-])ccc2ccccc12.[Ba+2] |
| InChI | InChI=1S/2C21H16O2.Ba/c2*1-23-19-13-11-15-7-3-5-9-17(15)21(19)20-16-8-4-2-6-14(16)10-12-18(20)22;/h2*2-13,22H,1H3;/q;;+2/p-2 |
| InChIKey | DUKFBZPTSIXUFK-UHFFFAOYSA-L |
| XLogP | 9.10 |
| TPSA | 64.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 736.03 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze barium(2+);bis(1-(2-methoxynaphthalen-1-yl)naphthalen-2-olate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);bis(1-(2-methoxynaphthalen-1-yl)naphthalen-2-olate)?
The IUPAC name of barium(2+);bis(1-(2-methoxynaphthalen-1-yl)naphthalen-2-olate) (CID 10952722) is barium(2+);bis(1-(2-methoxynaphthalen-1-yl)naphthalen-2-olate).
What is the SMILES notation for barium(2+);bis(1-(2-methoxynaphthalen-1-yl)naphthalen-2-olate)?
The canonical SMILES for barium(2+);bis(1-(2-methoxynaphthalen-1-yl)naphthalen-2-olate) is COc1ccc2ccccc2c1-c1c([O-])ccc2ccccc12.COc1ccc2ccccc2c1-c1c([O-])ccc2ccccc12.[Ba+2].
What is the InChIKey of barium(2+);bis(1-(2-methoxynaphthalen-1-yl)naphthalen-2-olate)?
The InChIKey is DUKFBZPTSIXUFK-UHFFFAOYSA-L. The full InChI is InChI=1S/2C21H16O2.Ba/c2*1-23-19-13-11-15-7-3-5-9-17(15)21(19)20-16-8-4-2-6-14(16)10-12-18(20)22;/h2*2-13,22H,1H3;/q;;+2/p-2.
What are the key properties of barium(2+);bis(1-(2-methoxynaphthalen-1-yl)naphthalen-2-olate)?
barium(2+);bis(1-(2-methoxynaphthalen-1-yl)naphthalen-2-olate) has a molecular weight of 736.03 g/mol, XLogP of 9.10, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);bis(1-(2-methoxynaphthalen-1-yl)naphthalen-2-olate) is sourced from PubChem (CID 10952722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).