C21H18F6N4O — CID 10226225
[(5R)-5-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-5-phenyl-1,4-dihydroimidazol-2-yl]cyanamide (PubChem CID 10226225) has the molecular formula C21H18F6N4O and a molecular weight of 456.39 g/mol. Its IUPAC name is [(5R)-5-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-5-phenyl-1,4-dihydroimidazol-2-yl]cyanamide.
| Compound Name | [(5R)-5-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-5-phenyl-1,4-dihydroimidazol-2-yl]cyanamide |
|---|---|
| PubChem CID | 10226225 |
| Molecular Formula | C21H18F6N4O |
| Molecular Weight | 456.39 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | [(5R)-5-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-5-phenyl-1,4-dihydroimidazol-2-yl]cyanamide |
| SMILES | C[C@@H](OC[C@@]1(c2ccccc2)CN=C(NC#N)N1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H18F6N4O/c1-13(14-7-16(20(22,23)24)9-17(8-14)21(25,26)27)32-11-19(15-5-3-2-4-6-15)10-29-18(31-19)30-12-28/h2-9,13H,10-11H2,1H3,(H2,29,30,31)/t13-,19-/m1/s1 |
| InChIKey | QMTLKKCQJIJVAR-BFUOFWGJSA-N |
| XLogP | 4.73 |
| TPSA | 69.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.39 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|