C12H19NO — CID 102262776
4-(2,6-dimethyl-4-pyridinyl)-3-methylbutan-2-ol (PubChem CID 102262776) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 4-(2,6-dimethyl-4-pyridinyl)-3-methylbutan-2-ol.
| Compound Name | 4-(2,6-dimethyl-4-pyridinyl)-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 102262776 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 4-(2,6-dimethyl-4-pyridinyl)-3-methylbutan-2-ol |
| SMILES | Cc1cc(CC(C)C(C)O)cc(C)n1 |
| InChI | InChI=1S/C12H19NO/c1-8(11(4)14)5-12-6-9(2)13-10(3)7-12/h6-8,11,14H,5H2,1-4H3 |
| InChIKey | CWQSXSJVQLOSHN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |