C29H48O4Si — CID 102263056
(2E,4E)-6-[(2R,3S,6S,8R,10R)-10-butyl-10-[tert-butyl(dimethyl)silyl]oxy-8-ethynyl-3-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]-4-methylhexa-2,4-dienal (PubChem CID 102263056) has the molecular formula C29H48O4Si and a molecular weight of 488.79 g/mol. Its IUPAC name is (2E,4E)-6-[(2R,3S,6S,8R,10R)-10-butyl-10-[tert-butyl(dimethyl)silyl]oxy-8-ethynyl-3-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]-4-methylhexa-2,4-dienal.
| Compound Name | (2E,4E)-6-[(2R,3S,6S,8R,10R)-10-butyl-10-[tert-butyl(dimethyl)silyl]oxy-8-ethynyl-3-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]-4-methylhexa-2,4-dienal |
|---|---|
| PubChem CID | 102263056 |
| Molecular Formula | C29H48O4Si |
| Molecular Weight | 488.79 g/mol |
| Exact Mass | 488.33 |
| IUPAC Name | (2E,4E)-6-[(2R,3S,6S,8R,10R)-10-butyl-10-[tert-butyl(dimethyl)silyl]oxy-8-ethynyl-3-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]-4-methylhexa-2,4-dienal |
| SMILES | C#C[C@H]1C[C@@](CCCC)(O[Si](C)(C)C(C)(C)C)C[C@]2(CC[C@H](C)[C@@H](C/C=C(C)/C=C/C=O)O2)O1 |
| InChI | InChI=1S/C29H48O4Si/c1-10-12-18-28(33-34(8,9)27(5,6)7)21-25(11-2)31-29(22-28)19-17-24(4)26(32-29)16-15-23(3)14-13-20-30/h2,13-15,20,24-26H,10,12,16-19,21-22H2,1,3-9H3/b14-13+,23-15+/t24-,25-,26+,28+,29+/m0/s1 |
| InChIKey | IIXISJPRLYGPQK-YNRIEHFBSA-N |
| XLogP | 7.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.79 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|