C31H48O5 — CID 71433679
10-(2-butyl-2-hexa-2,4-dienyl-8-methyl-1,10-dioxaspiro[4.5]decan-9-yl)-5-hydroxy-4,8-dimethyldeca-2,6,8-trienoic acid (PubChem CID 71433679) has the molecular formula C31H48O5 and a molecular weight of 500.72 g/mol. Its IUPAC name is 10-(2-butyl-2-hexa-2,4-dienyl-8-methyl-1,10-dioxaspiro[4.5]decan-9-yl)-5-hydroxy-4,8-dimethyldeca-2,6,8-trienoic acid.
| Compound Name | 10-(2-butyl-2-hexa-2,4-dienyl-8-methyl-1,10-dioxaspiro[4.5]decan-9-yl)-5-hydroxy-4,8-dimethyldeca-2,6,8-trienoic acid |
|---|---|
| PubChem CID | 71433679 |
| Molecular Formula | C31H48O5 |
| Molecular Weight | 500.72 g/mol |
| Exact Mass | 500.35 |
| IUPAC Name | 10-(2-butyl-2-hexa-2,4-dienyl-8-methyl-1,10-dioxaspiro[4.5]decan-9-yl)-5-hydroxy-4,8-dimethyldeca-2,6,8-trienoic acid |
| SMILES | CC=CC=CCC1(CCCC)CCC2(CCC(C)C(CC=C(C)C=CC(O)C(C)C=CC(=O)O)O2)O1 |
| InChI | InChI=1S/C31H48O5/c1-6-8-10-11-20-30(19-9-7-2)22-23-31(36-30)21-18-26(5)28(35-31)16-13-24(3)12-15-27(32)25(4)14-17-29(33)34/h6,8,10-15,17,25-28,32H,7,9,16,18-23H2,1-5H3,(H,33,34) |
| InChIKey | RJNISOMHQLGWDI-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.72 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|