C35H56O6 — CID 160623618
(2E,6E,8E)-11-[(2S)-5-butyl-6-[(1E,3E)-3-methyl-6-oxoocta-1,3-dienyl]oxan-2-yl]oxy-5-hydroxy-4,8,12-trimethyltetradeca-2,6,8-trienoic acid (PubChem CID 160623618) has the molecular formula C35H56O6 and a molecular weight of 572.83 g/mol. Its IUPAC name is (2E,6E,8E)-11-[(2S)-5-butyl-6-[(1E,3E)-3-methyl-6-oxoocta-1,3-dienyl]oxan-2-yl]oxy-5-hydroxy-4,8,12-trimethyltetradeca-2,6,8-trienoic acid.
| Compound Name | (2E,6E,8E)-11-[(2S)-5-butyl-6-[(1E,3E)-3-methyl-6-oxoocta-1,3-dienyl]oxan-2-yl]oxy-5-hydroxy-4,8,12-trimethyltetradeca-2,6,8-trienoic acid |
|---|---|
| PubChem CID | 160623618 |
| Molecular Formula | C35H56O6 |
| Molecular Weight | 572.83 g/mol |
| Exact Mass | 572.41 |
| IUPAC Name | (2E,6E,8E)-11-[(2S)-5-butyl-6-[(1E,3E)-3-methyl-6-oxoocta-1,3-dienyl]oxan-2-yl]oxy-5-hydroxy-4,8,12-trimethyltetradeca-2,6,8-trienoic acid |
| SMILES | CCCCC1CC[C@@H](OC(C/C=C(C)/C=C/C(O)C(C)/C=C/C(=O)O)C(C)CC)OC1/C=C/C(C)=C/CC(=O)CC |
| InChI | InChI=1S/C35H56O6/c1-8-11-12-29-18-24-35(41-33(29)22-16-25(4)13-19-30(36)10-3)40-32(27(6)9-2)21-15-26(5)14-20-31(37)28(7)17-23-34(38)39/h13-17,20,22-23,27-29,31-33,35,37H,8-12,18-19,21,24H2,1-7H3,(H,38,39)/b20-14+,22-16+,23-17+,25-13+,26-15+/t27?,28?,29?,31?,32?,33?,35-/m0/s1 |
| InChIKey | RGZZOCFMWDYFNS-RWZXQFDVSA-N |
| XLogP | 8.13 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.83 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|