C34H54O4 — CID 56928228
(4E,6E)-7-[(6S)-3-butyl-8-[(2E,4E,8E)-6-hydroxy-3,7-dimethyldeca-2,4,8-trienyl]-9-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]-5-methylhepta-4,6-dien-2-one (PubChem CID 56928228) has the molecular formula C34H54O4 and a molecular weight of 526.80 g/mol. Its IUPAC name is (4E,6E)-7-[(6S)-3-butyl-8-[(2E,4E,8E)-6-hydroxy-3,7-dimethyldeca-2,4,8-trienyl]-9-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]-5-methylhepta-4,6-dien-2-one.
| Compound Name | (4E,6E)-7-[(6S)-3-butyl-8-[(2E,4E,8E)-6-hydroxy-3,7-dimethyldeca-2,4,8-trienyl]-9-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]-5-methylhepta-4,6-dien-2-one |
|---|---|
| PubChem CID | 56928228 |
| Molecular Formula | C34H54O4 |
| Molecular Weight | 526.80 g/mol |
| Exact Mass | 526.40 |
| IUPAC Name | (4E,6E)-7-[(6S)-3-butyl-8-[(2E,4E,8E)-6-hydroxy-3,7-dimethyldeca-2,4,8-trienyl]-9-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]-5-methylhepta-4,6-dien-2-one |
| SMILES | C/C=C/C(C)C(O)/C=C/C(C)=C/CC1O[C@]2(CCC1C)CCC(CCCC)C(/C=C/C(C)=C/CC(C)=O)O2 |
| InChI | InChI=1S/C34H54O4/c1-8-10-12-30-22-24-34(38-33(30)20-16-25(3)13-17-29(7)35)23-21-28(6)32(37-34)19-15-26(4)14-18-31(36)27(5)11-9-2/h9,11,13-16,18,20,27-28,30-33,36H,8,10,12,17,19,21-24H2,1-7H3/b11-9+,18-14+,20-16+,25-13+,26-15+/t27?,28?,30?,31?,32?,33?,34-/m0/s1 |
| InChIKey | PEROFROABIHXFA-QQMDXJPUSA-N |
| XLogP | 8.43 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.80 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|