C22H33IO4 — CID 11547635
methyl (2E,4E)-5-[(2R,3S,6R,8R,9S)-8-[(E)-3-iodobut-2-enyl]-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]-3-methylpenta-2,4-dienoate (PubChem CID 11547635) has the molecular formula C22H33IO4 and a molecular weight of 488.41 g/mol. Its IUPAC name is methyl (2E,4E)-5-[(2R,3S,6R,8R,9S)-8-[(E)-3-iodobut-2-enyl]-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]-3-methylpenta-2,4-dienoate.
| Compound Name | methyl (2E,4E)-5-[(2R,3S,6R,8R,9S)-8-[(E)-3-iodobut-2-enyl]-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]-3-methylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 11547635 |
| Molecular Formula | C22H33IO4 |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | methyl (2E,4E)-5-[(2R,3S,6R,8R,9S)-8-[(E)-3-iodobut-2-enyl]-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]-3-methylpenta-2,4-dienoate |
| SMILES | COC(=O)/C=C(C)/C=C/[C@@H]1O[C@@]2(CC[C@@H]1C)CC[C@H](C)[C@@H](C/C=C(\C)I)O2 |
| InChI | InChI=1S/C22H33IO4/c1-15(14-21(24)25-5)6-8-19-16(2)10-12-22(26-19)13-11-17(3)20(27-22)9-7-18(4)23/h6-8,14,16-17,19-20H,9-13H2,1-5H3/b8-6+,15-14+,18-7+/t16-,17-,19-,20+,22+/m0/s1 |
| InChIKey | VFOMPWAQTDCSOK-OBSIKYKCSA-N |
| XLogP | 5.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|