C39H54O9 — CID 90934564
4-O-[(2S,3R,6S,8R,9S)-3-butyl-8-(6-hydroxy-3-methyl-6-phenylhexa-2,4-dienyl)-2-(5-methoxy-3-methyl-5-oxopenta-1,3-dienyl)-9-methyl-1,7-dioxaspiro[5.5]undecan-3-yl] 1-O-methyl butanedioate (PubChem CID 90934564) has the molecular formula C39H54O9 and a molecular weight of 666.85 g/mol. Its IUPAC name is 4-O-[(2S,3R,6S,8R,9S)-3-butyl-8-(6-hydroxy-3-methyl-6-phenylhexa-2,4-dienyl)-2-(5-methoxy-3-methyl-5-oxopenta-1,3-dienyl)-9-methyl-1,7-dioxaspiro[5.5]undecan-3-yl] 1-O-methyl butanedioate.
| Compound Name | 4-O-[(2S,3R,6S,8R,9S)-3-butyl-8-(6-hydroxy-3-methyl-6-phenylhexa-2,4-dienyl)-2-(5-methoxy-3-methyl-5-oxopenta-1,3-dienyl)-9-methyl-1,7-dioxaspiro[5.5]undecan-3-yl] 1-O-methyl butanedioate |
|---|---|
| PubChem CID | 90934564 |
| Molecular Formula | C39H54O9 |
| Molecular Weight | 666.85 g/mol |
| Exact Mass | 666.38 |
| IUPAC Name | 4-O-[(2S,3R,6S,8R,9S)-3-butyl-8-(6-hydroxy-3-methyl-6-phenylhexa-2,4-dienyl)-2-(5-methoxy-3-methyl-5-oxopenta-1,3-dienyl)-9-methyl-1,7-dioxaspiro[5.5]undecan-3-yl] 1-O-methyl butanedioate |
| SMILES | CCCC[C@@]1(OC(=O)CCC(=O)OC)CC[C@]2(CC[C@H](C)[C@@H](CC=C(C)C=CC(O)c3ccccc3)O2)O[C@H]1C=CC(C)=CC(=O)OC |
| InChI | InChI=1S/C39H54O9/c1-7-8-23-38(48-36(42)21-20-35(41)44-5)25-26-39(47-34(38)19-16-29(3)27-37(43)45-6)24-22-30(4)33(46-39)18-15-28(2)14-17-32(40)31-12-10-9-11-13-31/h9-17,19,27,30,32-34,40H,7-8,18,20-26H2,1-6H3/t30-,32?,33+,34-,38+,39-/m0/s1 |
| InChIKey | DJJYQMFCVBLQJZ-SQKGIJBTSA-N |
| XLogP | 7.40 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.85 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|