C20H32O5 — CID 10831839
methyl (2E,4E,6R)-6-[(2R)-2-butyl-1,10-dioxaspiro[4.5]decan-2-yl]-6-hydroxy-3-methylhexa-2,4-dienoate (PubChem CID 10831839) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is methyl (2E,4E,6R)-6-[(2R)-2-butyl-1,10-dioxaspiro[4.5]decan-2-yl]-6-hydroxy-3-methylhexa-2,4-dienoate.
| Compound Name | methyl (2E,4E,6R)-6-[(2R)-2-butyl-1,10-dioxaspiro[4.5]decan-2-yl]-6-hydroxy-3-methylhexa-2,4-dienoate |
|---|---|
| PubChem CID | 10831839 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | methyl (2E,4E,6R)-6-[(2R)-2-butyl-1,10-dioxaspiro[4.5]decan-2-yl]-6-hydroxy-3-methylhexa-2,4-dienoate |
| SMILES | CCCC[C@]1([C@H](O)/C=C/C(C)=C/C(=O)OC)CCC2(CCCCO2)O1 |
| InChI | InChI=1S/C20H32O5/c1-4-5-10-19(12-13-20(25-19)11-6-7-14-24-20)17(21)9-8-16(2)15-18(22)23-3/h8-9,15,17,21H,4-7,10-14H2,1-3H3/b9-8+,16-15+/t17-,19-,20?/m1/s1 |
| InChIKey | WNCRPMXVRLKUSS-TXUONKIPSA-N |
| XLogP | 3.66 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|