(E,4R,5R)-4,6-dimethyl-5-(oxan-2-yloxy)hept-2-enoic acid

C14H24O4 — CID 10491305

IUPAC(E,4R,5R)-4,6-dimethyl-5-(oxan-2-yloxy)hept-2-enoic acid
SMILESCC(C)[C@@H](OC1CCCCO1)[C@H](C)/C=C/C(=O)O
InChIInChI=1S/C14H24O4/c1-10(2)14(11(3)7-8-12(15)16)18-13-6-4-5-9-17-13/h7-8,10-11,13-14H,4-6,9H2,1-3H3,(H,15,16)/b8-7+/t11-,13?,14-/m1/s1
InChIKeyBFAZXUUQRLPDMV-MAFJYDLISA-N
MW256.34 g/mol
LogP2.83
Rot. Bonds6

About (E,4R,5R)-4,6-dimethyl-5-(oxan-2-yloxy)hept-2-enoic acid

(E,4R,5R)-4,6-dimethyl-5-(oxan-2-yloxy)hept-2-enoic acid (PubChem CID 10491305) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is (E,4R,5R)-4,6-dimethyl-5-(oxan-2-yloxy)hept-2-enoic acid.

Molecular Properties

Compound Name(E,4R,5R)-4,6-dimethyl-5-(oxan-2-yloxy)hept-2-enoic acid
PubChem CID10491305
Molecular FormulaC14H24O4
Molecular Weight256.34 g/mol
Exact Mass256.17
IUPAC Name(E,4R,5R)-4,6-dimethyl-5-(oxan-2-yloxy)hept-2-enoic acid
SMILESCC(C)[C@@H](OC1CCCCO1)[C@H](C)/C=C/C(=O)O
InChIInChI=1S/C14H24O4/c1-10(2)14(11(3)7-8-12(15)16)18-13-6-4-5-9-17-13/h7-8,10-11,13-14H,4-6,9H2,1-3H3,(H,15,16)/b8-7+/t11-,13?,14-/m1/s1
InChIKeyBFAZXUUQRLPDMV-MAFJYDLISA-N
XLogP2.83
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.34
LogP ≤ 52.83
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E,4R,5R)-4,6-dimethyl-5-(oxan-2-yloxy)hept-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E,4R,5R)-4,6-dimethyl-5-(oxan-2-yloxy)hept-2-enoic acid?
The IUPAC name of (E,4R,5R)-4,6-dimethyl-5-(oxan-2-yloxy)hept-2-enoic acid (CID 10491305) is (E,4R,5R)-4,6-dimethyl-5-(oxan-2-yloxy)hept-2-enoic acid.
What is the SMILES notation for (E,4R,5R)-4,6-dimethyl-5-(oxan-2-yloxy)hept-2-enoic acid?
The canonical SMILES for (E,4R,5R)-4,6-dimethyl-5-(oxan-2-yloxy)hept-2-enoic acid is CC(C)[C@@H](OC1CCCCO1)[C@H](C)/C=C/C(=O)O.
What is the InChIKey of (E,4R,5R)-4,6-dimethyl-5-(oxan-2-yloxy)hept-2-enoic acid?
The InChIKey is BFAZXUUQRLPDMV-MAFJYDLISA-N. The full InChI is InChI=1S/C14H24O4/c1-10(2)14(11(3)7-8-12(15)16)18-13-6-4-5-9-17-13/h7-8,10-11,13-14H,4-6,9H2,1-3H3,(H,15,16)/b8-7+/t11-,13?,14-/m1/s1.
What are the key properties of (E,4R,5R)-4,6-dimethyl-5-(oxan-2-yloxy)hept-2-enoic acid?
(E,4R,5R)-4,6-dimethyl-5-(oxan-2-yloxy)hept-2-enoic acid has a molecular weight of 256.34 g/mol, XLogP of 2.83, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E,4R,5R)-4,6-dimethyl-5-(oxan-2-yloxy)hept-2-enoic acid is sourced from PubChem (CID 10491305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).