C14H24O4 — CID 10491305
(E,4R,5R)-4,6-dimethyl-5-(oxan-2-yloxy)hept-2-enoic acid (PubChem CID 10491305) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is (E,4R,5R)-4,6-dimethyl-5-(oxan-2-yloxy)hept-2-enoic acid.
| Compound Name | (E,4R,5R)-4,6-dimethyl-5-(oxan-2-yloxy)hept-2-enoic acid |
|---|---|
| PubChem CID | 10491305 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | (E,4R,5R)-4,6-dimethyl-5-(oxan-2-yloxy)hept-2-enoic acid |
| SMILES | CC(C)[C@@H](OC1CCCCO1)[C@H](C)/C=C/C(=O)O |
| InChI | InChI=1S/C14H24O4/c1-10(2)14(11(3)7-8-12(15)16)18-13-6-4-5-9-17-13/h7-8,10-11,13-14H,4-6,9H2,1-3H3,(H,15,16)/b8-7+/t11-,13?,14-/m1/s1 |
| InChIKey | BFAZXUUQRLPDMV-MAFJYDLISA-N |
| XLogP | 2.83 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|