C12H21F3O2S2 — CID 102263070
(7S)-8,8,8-trifluoro-7-[(2S)-1-oxo-1,3-dithian-2-yl]octan-1-ol (PubChem CID 102263070) has the molecular formula C12H21F3O2S2 and a molecular weight of 318.43 g/mol. Its IUPAC name is (7S)-8,8,8-trifluoro-7-[(2S)-1-oxo-1,3-dithian-2-yl]octan-1-ol.
| Compound Name | (7S)-8,8,8-trifluoro-7-[(2S)-1-oxo-1,3-dithian-2-yl]octan-1-ol |
|---|---|
| PubChem CID | 102263070 |
| Molecular Formula | C12H21F3O2S2 |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | (7S)-8,8,8-trifluoro-7-[(2S)-1-oxo-1,3-dithian-2-yl]octan-1-ol |
| SMILES | O=S1CCCS[C@@H]1[C@@H](CCCCCCO)C(F)(F)F |
| InChI | InChI=1S/C12H21F3O2S2/c13-12(14,15)10(6-3-1-2-4-7-16)11-18-8-5-9-19(11)17/h10-11,16H,1-9H2/t10-,11+,19?/m1/s1 |
| InChIKey | POHQJOXWZZZTHI-SWVITMIESA-N |
| XLogP | 3.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|