C8H14F2O3S — CID 105485476
3-(1,1-dioxothian-3-yl)-2,2-difluoropropan-1-ol (PubChem CID 105485476) has the molecular formula C8H14F2O3S and a molecular weight of 228.26 g/mol. Its IUPAC name is 3-(1,1-dioxothian-3-yl)-2,2-difluoropropan-1-ol.
| Compound Name | 3-(1,1-dioxothian-3-yl)-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 105485476 |
| Molecular Formula | C8H14F2O3S |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 3-(1,1-dioxothian-3-yl)-2,2-difluoropropan-1-ol |
| SMILES | O=S1(=O)CCCC(CC(F)(F)CO)C1 |
| InChI | InChI=1S/C8H14F2O3S/c9-8(10,6-11)4-7-2-1-3-14(12,13)5-7/h7,11H,1-6H2 |
| InChIKey | HGPNFOCXKNHHKY-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |